C16H15Cl2N3 — CID 81494685
1-(3,4-dichlorophenyl)-2-(1-methylindazol-3-yl)ethanamine (PubChem CID 81494685) has the molecular formula C16H15Cl2N3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(1-methylindazol-3-yl)ethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(1-methylindazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 81494685 |
| Molecular Formula | C16H15Cl2N3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(1-methylindazol-3-yl)ethanamine |
| SMILES | Cn1nc(CC(N)c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C16H15Cl2N3/c1-21-16-5-3-2-4-11(16)15(20-21)9-14(19)10-6-7-12(17)13(18)8-10/h2-8,14H,9,19H2,1H3 |
| InChIKey | PJOHANZRMKQIID-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |