C10H10Cl2N2OS — CID 107969663
(2,5-dichlorothiophen-3-yl)-(2-ethylpyrazol-3-yl)methanol (PubChem CID 107969663) has the molecular formula C10H10Cl2N2OS and a molecular weight of 277.18 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2-ethylpyrazol-3-yl)methanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2-ethylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 107969663 |
| Molecular Formula | C10H10Cl2N2OS |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2-ethylpyrazol-3-yl)methanol |
| SMILES | CCn1nccc1C(O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H10Cl2N2OS/c1-2-14-7(3-4-13-14)9(15)6-5-8(11)16-10(6)12/h3-5,9,15H,2H2,1H3 |
| InChIKey | PJEOOWBWOPISMY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |