C14H11ClN2OS — CID 62276328
(5-chlorothiophen-2-yl)-(1-phenylpyrazol-4-yl)methanol (PubChem CID 62276328) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(1-phenylpyrazol-4-yl)methanol.
| Compound Name | (5-chlorothiophen-2-yl)-(1-phenylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 62276328 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(1-phenylpyrazol-4-yl)methanol |
| SMILES | OC(c1cnn(-c2ccccc2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H11ClN2OS/c15-13-7-6-12(19-13)14(18)10-8-16-17(9-10)11-4-2-1-3-5-11/h1-9,14,18H |
| InChIKey | WPYQVBHKZMKCDE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |