C14H16Br2N2OS — CID 107970581
[(2,5-dibromothiophen-3-yl)-(2-propoxyphenyl)methyl]hydrazine (PubChem CID 107970581) has the molecular formula C14H16Br2N2OS and a molecular weight of 420.17 g/mol. Its IUPAC name is [(2,5-dibromothiophen-3-yl)-(2-propoxyphenyl)methyl]hydrazine.
| Compound Name | [(2,5-dibromothiophen-3-yl)-(2-propoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970581 |
| Molecular Formula | C14H16Br2N2OS |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | [(2,5-dibromothiophen-3-yl)-(2-propoxyphenyl)methyl]hydrazine |
| SMILES | CCCOc1ccccc1C(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H16Br2N2OS/c1-2-7-19-11-6-4-3-5-9(11)13(18-17)10-8-12(15)20-14(10)16/h3-6,8,13,18H,2,7,17H2,1H3 |
| InChIKey | CRWRMAKPOJMTMO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|