C13H11Br2ClOS — CID 55198913
2,5-dibromo-3-[chloro-(2-ethoxyphenyl)methyl]thiophene (PubChem CID 55198913) has the molecular formula C13H11Br2ClOS and a molecular weight of 410.56 g/mol. Its IUPAC name is 2,5-dibromo-3-[chloro-(2-ethoxyphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[chloro-(2-ethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 55198913 |
| Molecular Formula | C13H11Br2ClOS |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 407.86 |
| IUPAC Name | 2,5-dibromo-3-[chloro-(2-ethoxyphenyl)methyl]thiophene |
| SMILES | CCOc1ccccc1C(Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H11Br2ClOS/c1-2-17-10-6-4-3-5-8(10)12(16)9-7-11(14)18-13(9)15/h3-7,12H,2H2,1H3 |
| InChIKey | BRMICUFLEZEGLC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|