C10H13Br2ClS — CID 63436226
2,5-dibromo-3-(1-chloro-2,2-dimethylbutyl)thiophene (PubChem CID 63436226) has the molecular formula C10H13Br2ClS and a molecular weight of 360.54 g/mol. Its IUPAC name is 2,5-dibromo-3-(1-chloro-2,2-dimethylbutyl)thiophene.
| Compound Name | 2,5-dibromo-3-(1-chloro-2,2-dimethylbutyl)thiophene |
|---|---|
| PubChem CID | 63436226 |
| Molecular Formula | C10H13Br2ClS |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | 2,5-dibromo-3-(1-chloro-2,2-dimethylbutyl)thiophene |
| SMILES | CCC(C)(C)C(Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H13Br2ClS/c1-4-10(2,3)8(13)6-5-7(11)14-9(6)12/h5,8H,4H2,1-3H3 |
| InChIKey | CXFDQXOHJODWII-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|