C7H2Br2ClF5S — CID 63436219
2,5-dibromo-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)thiophene (PubChem CID 63436219) has the molecular formula C7H2Br2ClF5S and a molecular weight of 408.41 g/mol. Its IUPAC name is 2,5-dibromo-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)thiophene.
| Compound Name | 2,5-dibromo-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)thiophene |
|---|---|
| PubChem CID | 63436219 |
| Molecular Formula | C7H2Br2ClF5S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 405.79 |
| IUPAC Name | 2,5-dibromo-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)thiophene |
| SMILES | FC(F)(F)C(F)(F)C(Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H2Br2ClF5S/c8-3-1-2(5(9)16-3)4(10)6(11,12)7(13,14)15/h1,4H |
| InChIKey | JTNMNQDQTXBREF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|