C12H6Br2ClF3OS — CID 116629141
2,5-dibromo-3-[chloro-[4-(trifluoromethoxy)phenyl]methyl]thiophene (PubChem CID 116629141) has the molecular formula C12H6Br2ClF3OS and a molecular weight of 450.50 g/mol. Its IUPAC name is 2,5-dibromo-3-[chloro-[4-(trifluoromethoxy)phenyl]methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[chloro-[4-(trifluoromethoxy)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 116629141 |
| Molecular Formula | C12H6Br2ClF3OS |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 447.81 |
| IUPAC Name | 2,5-dibromo-3-[chloro-[4-(trifluoromethoxy)phenyl]methyl]thiophene |
| SMILES | FC(F)(F)Oc1ccc(C(Cl)c2cc(Br)sc2Br)cc1 |
| InChI | InChI=1S/C12H6Br2ClF3OS/c13-9-5-8(11(14)20-9)10(15)6-1-3-7(4-2-6)19-12(16,17)18/h1-5,10H |
| InChIKey | XJWWPGQZOKBZLK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|