C14H14Br2N2OS — CID 107970651
[(3-cyclopropyloxyphenyl)-(2,5-dibromothiophen-3-yl)methyl]hydrazine (PubChem CID 107970651) has the molecular formula C14H14Br2N2OS and a molecular weight of 418.15 g/mol. Its IUPAC name is [(3-cyclopropyloxyphenyl)-(2,5-dibromothiophen-3-yl)methyl]hydrazine.
| Compound Name | [(3-cyclopropyloxyphenyl)-(2,5-dibromothiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970651 |
| Molecular Formula | C14H14Br2N2OS |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | [(3-cyclopropyloxyphenyl)-(2,5-dibromothiophen-3-yl)methyl]hydrazine |
| SMILES | NNC(c1cccc(OC2CC2)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H14Br2N2OS/c15-12-7-11(14(16)20-12)13(18-17)8-2-1-3-10(6-8)19-9-4-5-9/h1-3,6-7,9,13,18H,4-5,17H2 |
| InChIKey | VXUDMJGOLGRCIK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|