C17H20BrNOS — CID 105051665
N-[(5-bromo-4-methylthiophen-2-yl)-(3-cyclopropyloxyphenyl)methyl]ethanamine (PubChem CID 105051665) has the molecular formula C17H20BrNOS and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[(5-bromo-4-methylthiophen-2-yl)-(3-cyclopropyloxyphenyl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-cyclopropyloxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105051665 |
| Molecular Formula | C17H20BrNOS |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[(5-bromo-4-methylthiophen-2-yl)-(3-cyclopropyloxyphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(OC2CC2)c1)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C17H20BrNOS/c1-3-19-16(15-9-11(2)17(18)21-15)12-5-4-6-14(10-12)20-13-7-8-13/h4-6,9-10,13,16,19H,3,7-8H2,1-2H3 |
| InChIKey | FVGIRQZDDWNSOG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |