C18H20BrNO — CID 114521545
N-[(3-bromophenyl)-(3-cyclopropyloxyphenyl)methyl]ethanamine (PubChem CID 114521545) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is N-[(3-bromophenyl)-(3-cyclopropyloxyphenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromophenyl)-(3-cyclopropyloxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114521545 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[(3-bromophenyl)-(3-cyclopropyloxyphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Br)c1)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C18H20BrNO/c1-2-20-18(13-5-3-7-15(19)11-13)14-6-4-8-17(12-14)21-16-9-10-16/h3-8,11-12,16,18,20H,2,9-10H2,1H3 |
| InChIKey | YLNWNRPFKYHDDS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |