2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid

C12H9Br2NO3 — CID 107971562

IUPAC2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid
SMILESC#CCN(CC(=O)O)C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C12H9Br2NO3/c1-2-3-15(7-11(16)17)12(18)8-4-9(13)6-10(14)5-8/h1,4-6H,3,7H2,(H,16,17)
InChIKeyDTEUAAYJDBHIQA-UHFFFAOYSA-N
MW375.02 g/mol
LogP2.37
Rot. Bonds4

About 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid

2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid (PubChem CID 107971562) has the molecular formula C12H9Br2NO3 and a molecular weight of 375.02 g/mol. Its IUPAC name is 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid.

Molecular Properties

Compound Name2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid
PubChem CID107971562
Molecular FormulaC12H9Br2NO3
Molecular Weight375.02 g/mol
Exact Mass372.89
IUPAC Name2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid
SMILESC#CCN(CC(=O)O)C(=O)c1cc(Br)cc(Br)c1
InChIInChI=1S/C12H9Br2NO3/c1-2-3-15(7-11(16)17)12(18)8-4-9(13)6-10(14)5-8/h1,4-6H,3,7H2,(H,16,17)
InChIKeyDTEUAAYJDBHIQA-UHFFFAOYSA-N
XLogP2.37
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500375.02
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid?
The IUPAC name of 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid (CID 107971562) is 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid.
What is the SMILES notation for 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid?
The canonical SMILES for 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid is C#CCN(CC(=O)O)C(=O)c1cc(Br)cc(Br)c1.
What is the InChIKey of 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid?
The InChIKey is DTEUAAYJDBHIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br2NO3/c1-2-3-15(7-11(16)17)12(18)8-4-9(13)6-10(14)5-8/h1,4-6H,3,7H2,(H,16,17).
What are the key properties of 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid?
2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid has a molecular weight of 375.02 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dibromobenzoyl)-prop-2-ynylamino]acetic acid is sourced from PubChem (CID 107971562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).