C13H11NO — CID 11790147
N,N-bis(prop-2-ynyl)benzamide (PubChem CID 11790147) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is N,N-bis(prop-2-ynyl)benzamide.
| Compound Name | N,N-bis(prop-2-ynyl)benzamide |
|---|---|
| PubChem CID | 11790147 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | N,N-bis(prop-2-ynyl)benzamide |
| SMILES | C#CCN(CC#C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H11NO/c1-3-10-14(11-4-2)13(15)12-8-6-5-7-9-12/h1-2,5-9H,10-11H2 |
| InChIKey | FTABCUBEXYEQGD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|