C15H15NOS2 — CID 164718481
N,N-bis(prop-2-ynyl)-3,5-bis(sulfanylmethyl)benzamide (PubChem CID 164718481) has the molecular formula C15H15NOS2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N,N-bis(prop-2-ynyl)-3,5-bis(sulfanylmethyl)benzamide.
| Compound Name | N,N-bis(prop-2-ynyl)-3,5-bis(sulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 164718481 |
| Molecular Formula | C15H15NOS2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N,N-bis(prop-2-ynyl)-3,5-bis(sulfanylmethyl)benzamide |
| SMILES | C#CCN(CC#C)C(=O)c1cc(CS)cc(CS)c1 |
| InChI | InChI=1S/C15H15NOS2/c1-3-5-16(6-4-2)15(17)14-8-12(10-18)7-13(9-14)11-19/h1-2,7-9,18-19H,5-6,10-11H2 |
| InChIKey | GQWDLDMZOWTVNO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|