C13H8Br2N2OS — CID 107972780
3-(3,5-dibromophenyl)-4-thiophen-2-yl-1,2-oxazol-5-amine (PubChem CID 107972780) has the molecular formula C13H8Br2N2OS and a molecular weight of 400.10 g/mol. Its IUPAC name is 3-(3,5-dibromophenyl)-4-thiophen-2-yl-1,2-oxazol-5-amine.
| Compound Name | 3-(3,5-dibromophenyl)-4-thiophen-2-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 107972780 |
| Molecular Formula | C13H8Br2N2OS |
| Molecular Weight | 400.10 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 3-(3,5-dibromophenyl)-4-thiophen-2-yl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2cc(Br)cc(Br)c2)c1-c1cccs1 |
| InChI | InChI=1S/C13H8Br2N2OS/c14-8-4-7(5-9(15)6-8)12-11(13(16)18-17-12)10-2-1-3-19-10/h1-6H,16H2 |
| InChIKey | GRGVBJYNNHLQIT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.10 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |