C12H12BrF2N3 — CID 107978022
1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1-methylimidazol-4-yl)methanamine (PubChem CID 107978022) has the molecular formula C12H12BrF2N3 and a molecular weight of 316.15 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1-methylimidazol-4-yl)methanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1-methylimidazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107978022 |
| Molecular Formula | C12H12BrF2N3 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1-methylimidazol-4-yl)methanamine |
| SMILES | CNC(c1cn(C)cn1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H12BrF2N3/c1-16-12(9-5-18(2)6-17-9)10-8(14)4-3-7(13)11(10)15/h3-6,12,16H,1-2H3 |
| InChIKey | ADSJWZMIQZWGCD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|