C14H15F4N3 — CID 107978068
N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(1-methylimidazol-4-yl)methyl]ethanamine (PubChem CID 107978068) has the molecular formula C14H15F4N3 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(1-methylimidazol-4-yl)methyl]ethanamine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(1-methylimidazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107978068 |
| Molecular Formula | C14H15F4N3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]-(1-methylimidazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)c(C(F)(F)F)c1)c1cn(C)cn1 |
| InChI | InChI=1S/C14H15F4N3/c1-3-19-13(12-7-21(2)8-20-12)9-4-5-11(15)10(6-9)14(16,17)18/h4-8,13,19H,3H2,1-2H3 |
| InChIKey | QGSFPKSFGBSSPS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |