C14H14Br2N2 — CID 107980663
1-(3,5-dibromophenyl)-2-(5-methyl-2-pyridinyl)ethanamine (PubChem CID 107980663) has the molecular formula C14H14Br2N2 and a molecular weight of 370.09 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-2-(5-methyl-2-pyridinyl)ethanamine.
| Compound Name | 1-(3,5-dibromophenyl)-2-(5-methyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 107980663 |
| Molecular Formula | C14H14Br2N2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 1-(3,5-dibromophenyl)-2-(5-methyl-2-pyridinyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2cc(Br)cc(Br)c2)nc1 |
| InChI | InChI=1S/C14H14Br2N2/c1-9-2-3-13(18-8-9)7-14(17)10-4-11(15)6-12(16)5-10/h2-6,8,14H,7,17H2,1H3 |
| InChIKey | UODGGVXDNPMLAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |