C15H17BrN2 — CID 66446142
1-(5-bromo-2-methylphenyl)-2-(5-methyl-2-pyridinyl)ethanamine (PubChem CID 66446142) has the molecular formula C15H17BrN2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-2-(5-methyl-2-pyridinyl)ethanamine.
| Compound Name | 1-(5-bromo-2-methylphenyl)-2-(5-methyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 66446142 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-2-(5-methyl-2-pyridinyl)ethanamine |
| SMILES | Cc1ccc(CC(N)c2cc(Br)ccc2C)nc1 |
| InChI | InChI=1S/C15H17BrN2/c1-10-3-6-13(18-9-10)8-15(17)14-7-12(16)5-4-11(14)2/h3-7,9,15H,8,17H2,1-2H3 |
| InChIKey | CZMHBVSZTHEKIF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |