About 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine
2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine (PubChem CID 114376362) has the molecular formula C14H12Br2ClN
and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine.
Molecular Properties
| Compound Name | 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine |
| PubChem CID | 114376362 |
| Molecular Formula | C14H12Br2ClN |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 386.90 |
| IUPAC Name | 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine |
| SMILES | Cc1ccc(CC(Cl)c2cc(Br)ccc2Br)nc1 |
| InChI | InChI=1S/C14H12Br2ClN/c1-9-2-4-11(18-8-9)7-14(17)12-6-10(15)3-5-13(12)16/h2-6,8,14H,7H2,1H3 |
| InChIKey | KSTGOSXQCDSQID-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine?
The IUPAC name of 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine (CID 114376362) is 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine.
What is the SMILES notation for 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine?
The canonical SMILES for 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine is Cc1ccc(CC(Cl)c2cc(Br)ccc2Br)nc1.
What is the InChIKey of 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine?
The InChIKey is KSTGOSXQCDSQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br2ClN/c1-9-2-4-11(18-8-9)7-14(17)12-6-10(15)3-5-13(12)16/h2-6,8,14H,7H2,1H3.
What are the key properties of 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine?
2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine has a molecular weight of 389.52 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]-5-methylpyridine is sourced from PubChem (CID 114376362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).