C14H12Cl3N — CID 66461226
2-[2-chloro-2-(2,4-dichlorophenyl)ethyl]-5-methylpyridine (PubChem CID 66461226) has the molecular formula C14H12Cl3N and a molecular weight of 300.62 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,4-dichlorophenyl)ethyl]-5-methylpyridine.
| Compound Name | 2-[2-chloro-2-(2,4-dichlorophenyl)ethyl]-5-methylpyridine |
|---|---|
| PubChem CID | 66461226 |
| Molecular Formula | C14H12Cl3N |
| Molecular Weight | 300.62 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-[2-chloro-2-(2,4-dichlorophenyl)ethyl]-5-methylpyridine |
| SMILES | Cc1ccc(CC(Cl)c2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C14H12Cl3N/c1-9-2-4-11(18-8-9)7-14(17)12-5-3-10(15)6-13(12)16/h2-6,8,14H,7H2,1H3 |
| InChIKey | LBXPMCBACQREKX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|