C14H12BrCl2N — CID 66455303
2-[2-bromo-2-(3,4-dichlorophenyl)ethyl]-5-methylpyridine (PubChem CID 66455303) has the molecular formula C14H12BrCl2N and a molecular weight of 345.07 g/mol. Its IUPAC name is 2-[2-bromo-2-(3,4-dichlorophenyl)ethyl]-5-methylpyridine.
| Compound Name | 2-[2-bromo-2-(3,4-dichlorophenyl)ethyl]-5-methylpyridine |
|---|---|
| PubChem CID | 66455303 |
| Molecular Formula | C14H12BrCl2N |
| Molecular Weight | 345.07 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | 2-[2-bromo-2-(3,4-dichlorophenyl)ethyl]-5-methylpyridine |
| SMILES | Cc1ccc(CC(Br)c2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C14H12BrCl2N/c1-9-2-4-11(18-8-9)7-12(15)10-3-5-13(16)14(17)6-10/h2-6,8,12H,7H2,1H3 |
| InChIKey | PREUHMHRHIKWLL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|