C16H16BrNO — CID 66455523
2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine (PubChem CID 66455523) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine.
| Compound Name | 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine |
|---|---|
| PubChem CID | 66455523 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine |
| SMILES | Cc1ccc(CC(Br)c2ccc3c(c2)COC3)nc1 |
| InChI | InChI=1S/C16H16BrNO/c1-11-2-5-15(18-8-11)7-16(17)12-3-4-13-9-19-10-14(13)6-12/h2-6,8,16H,7,9-10H2,1H3 |
| InChIKey | WAYSRCDDFGFIFM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|