About 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine
2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine (PubChem CID 66455523) has the molecular formula C16H16BrNO
and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine.
Molecular Properties
| Compound Name | 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine |
| PubChem CID | 66455523 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine |
| SMILES | Cc1ccc(CC(Br)c2ccc3c(c2)COC3)nc1 |
| InChI | InChI=1S/C16H16BrNO/c1-11-2-5-15(18-8-11)7-16(17)12-3-4-13-9-19-10-14(13)6-12/h2-6,8,16H,7,9-10H2,1H3 |
| InChIKey | WAYSRCDDFGFIFM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine?
The IUPAC name of 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine (CID 66455523) is 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine.
What is the SMILES notation for 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine?
The canonical SMILES for 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine is Cc1ccc(CC(Br)c2ccc3c(c2)COC3)nc1.
What is the InChIKey of 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine?
The InChIKey is WAYSRCDDFGFIFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO/c1-11-2-5-15(18-8-11)7-16(17)12-3-4-13-9-19-10-14(13)6-12/h2-6,8,16H,7,9-10H2,1H3.
What are the key properties of 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine?
2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine has a molecular weight of 318.21 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)ethyl]-5-methylpyridine is sourced from PubChem (CID 66455523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).