C16H12BrClN2O — CID 107984272
5-(2-bromo-3-methylphenyl)-4-(4-chlorophenyl)-1,2-oxazol-3-amine (PubChem CID 107984272) has the molecular formula C16H12BrClN2O and a molecular weight of 363.64 g/mol. Its IUPAC name is 5-(2-bromo-3-methylphenyl)-4-(4-chlorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2-bromo-3-methylphenyl)-4-(4-chlorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 107984272 |
| Molecular Formula | C16H12BrClN2O |
| Molecular Weight | 363.64 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 5-(2-bromo-3-methylphenyl)-4-(4-chlorophenyl)-1,2-oxazol-3-amine |
| SMILES | Cc1cccc(-c2onc(N)c2-c2ccc(Cl)cc2)c1Br |
| InChI | InChI=1S/C16H12BrClN2O/c1-9-3-2-4-12(14(9)17)15-13(16(19)20-21-15)10-5-7-11(18)8-6-10/h2-8H,1H3,(H2,19,20) |
| InChIKey | ONNOHPVCQDCJRT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |