C10H11NO3 — CID 107986819
4-(but-2-ynoylamino)cyclopent-2-ene-1-carboxylic acid (PubChem CID 107986819) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-(but-2-ynoylamino)cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-(but-2-ynoylamino)cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 107986819 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-(but-2-ynoylamino)cyclopent-2-ene-1-carboxylic acid |
| SMILES | CC#CC(=O)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C10H11NO3/c1-2-3-9(12)11-8-5-4-7(6-8)10(13)14/h4-5,7-8H,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | GEAQXGBRDHXLAP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|