C13H11NO3 — CID 107986860
1-but-2-ynoyl-2,3-dihydroindole-3-carboxylic acid (PubChem CID 107986860) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-but-2-ynoyl-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-but-2-ynoyl-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 107986860 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-but-2-ynoyl-2,3-dihydroindole-3-carboxylic acid |
| SMILES | CC#CC(=O)N1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C13H11NO3/c1-2-5-12(15)14-8-10(13(16)17)9-6-3-4-7-11(9)14/h3-4,6-7,10H,8H2,1H3,(H,16,17) |
| InChIKey | TVFQRFWAJIKDTI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|