C17H15NO3 — CID 80563027
1-(2-phenylacetyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 80563027) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2-phenylacetyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(2-phenylacetyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 80563027 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-(2-phenylacetyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H15NO3/c19-16(10-12-6-2-1-3-7-12)18-11-14(17(20)21)13-8-4-5-9-15(13)18/h1-9,14H,10-11H2,(H,20,21) |
| InChIKey | YVAUJERJYLOOQM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |