C14H16N2O4S — CID 80562954
1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-2,3-dihydroindole-3-carboxylic acid (PubChem CID 80562954) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 80562954 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[3-(2-amino-2-oxoethyl)sulfanylpropanoyl]-2,3-dihydroindole-3-carboxylic acid |
| SMILES | NC(=O)CSCCC(=O)N1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H16N2O4S/c15-12(17)8-21-6-5-13(18)16-7-10(14(19)20)9-3-1-2-4-11(9)16/h1-4,10H,5-8H2,(H2,15,17)(H,19,20) |
| InChIKey | CJUQKVALIPNQLP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|