C16H15NO3S — CID 120691292
1-(3-thiophen-3-ylpropanoyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691292) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-(3-thiophen-3-ylpropanoyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(3-thiophen-3-ylpropanoyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691292 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(3-thiophen-3-ylpropanoyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)CCc2ccsc2)c2ccccc21 |
| InChI | InChI=1S/C16H15NO3S/c18-15(6-5-11-7-8-21-10-11)17-9-13(16(19)20)12-3-1-2-4-14(12)17/h1-4,7-8,10,13H,5-6,9H2,(H,19,20) |
| InChIKey | RHLZDOBMFOSTEC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |