C11H12N2O3 — CID 80565297
1-(2-amino-2-oxoethyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 80565297) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(2-amino-2-oxoethyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 80565297 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | NC(=O)CN1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C11H12N2O3/c12-10(14)6-13-5-8(11(15)16)7-3-1-2-4-9(7)13/h1-4,8H,5-6H2,(H2,12,14)(H,15,16) |
| InChIKey | SZZNTSOAGRJRJY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |