C9H7BrN2O — CID 107987937
N-(3-bromo-2-pyridinyl)but-2-ynamide (PubChem CID 107987937) has the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. Its IUPAC name is N-(3-bromo-2-pyridinyl)but-2-ynamide.
| Compound Name | N-(3-bromo-2-pyridinyl)but-2-ynamide |
|---|---|
| PubChem CID | 107987937 |
| Molecular Formula | C9H7BrN2O |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | N-(3-bromo-2-pyridinyl)but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ncccc1Br |
| InChI | InChI=1S/C9H7BrN2O/c1-2-4-8(13)12-9-7(10)5-3-6-11-9/h3,5-6H,1H3,(H,11,12,13) |
| InChIKey | RAGXJLAQFVCKHV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|