C13H9BrF2N2O — CID 112696541
N-(3-bromo-2-pyridinyl)-2,4-difluoro-5-methylbenzamide (PubChem CID 112696541) has the molecular formula C13H9BrF2N2O and a molecular weight of 327.13 g/mol. Its IUPAC name is N-(3-bromo-2-pyridinyl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(3-bromo-2-pyridinyl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 112696541 |
| Molecular Formula | C13H9BrF2N2O |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | N-(3-bromo-2-pyridinyl)-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ncccc2Br)c(F)cc1F |
| InChI | InChI=1S/C13H9BrF2N2O/c1-7-5-8(11(16)6-10(7)15)13(19)18-12-9(14)3-2-4-17-12/h2-6H,1H3,(H,17,18,19) |
| InChIKey | RMAFCLAZZWQTTF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |