C7H4F3N3S — CID 10798896
2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole (PubChem CID 10798896) has the molecular formula C7H4F3N3S and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole.
| Compound Name | 2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 10798896 |
| Molecular Formula | C7H4F3N3S |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1H-imidazol-2-yl]-1,3-thiazole |
| SMILES | FC(F)(F)c1cnc(-c2nccs2)[nH]1 |
| InChI | InChI=1S/C7H4F3N3S/c8-7(9,10)4-3-12-5(13-4)6-11-1-2-14-6/h1-3H,(H,12,13) |
| InChIKey | KNMQKNPQMFSWNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |