C14H22N6S2 — CID 13499363
1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[3-(1,3-thiazol-2-yl)propyl]guanidine (PubChem CID 13499363) has the molecular formula C14H22N6S2 and a molecular weight of 338.51 g/mol. Its IUPAC name is 1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[3-(1,3-thiazol-2-yl)propyl]guanidine.
| Compound Name | 1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[3-(1,3-thiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 13499363 |
| Molecular Formula | C14H22N6S2 |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[3-(1,3-thiazol-2-yl)propyl]guanidine |
| SMILES | Cc1[nH]cnc1CSCCN/C(N)=N/CCCc1nccs1 |
| InChI | InChI=1S/C14H22N6S2/c1-11-12(20-10-19-11)9-21-7-5-18-14(15)17-4-2-3-13-16-6-8-22-13/h6,8,10H,2-5,7,9H2,1H3,(H,19,20)(H3,15,17,18) |
| InChIKey | CEYYVXQQJQEDJZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|