C10H15NO2 — CID 107989485
N-[2-(2-methylprop-2-enoxy)ethyl]but-2-ynamide (PubChem CID 107989485) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]but-2-ynamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]but-2-ynamide |
|---|---|
| PubChem CID | 107989485 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]but-2-ynamide |
| SMILES | C=C(C)COCCNC(=O)C#CC |
| InChI | InChI=1S/C10H15NO2/c1-4-5-10(12)11-6-7-13-8-9(2)3/h2,6-8H2,1,3H3,(H,11,12) |
| InChIKey | DVGJMZUJHVXMNU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|