C8H15NO2S — CID 114469847
N-[2-(2-methylprop-2-enoxy)ethyl]-2-sulfanylacetamide (PubChem CID 114469847) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 114469847 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-2-sulfanylacetamide |
| SMILES | C=C(C)COCCNC(=O)CS |
| InChI | InChI=1S/C8H15NO2S/c1-7(2)5-11-4-3-9-8(10)6-12/h12H,1,3-6H2,2H3,(H,9,10) |
| InChIKey | IWBGOMKVQFINDO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|