C12H16N2O2 — CID 107989904
8-but-2-ynoyl-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 107989904) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 8-but-2-ynoyl-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-but-2-ynoyl-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 107989904 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 8-but-2-ynoyl-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC#CC(=O)N1CCC2(CC1)CNC(=O)C2 |
| InChI | InChI=1S/C12H16N2O2/c1-2-3-11(16)14-6-4-12(5-7-14)8-10(15)13-9-12/h4-9H2,1H3,(H,13,15) |
| InChIKey | WAPDHOAWPBRRRI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|