C15H18N2O4 — CID 114344968
8-(2,3-dihydroxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 114344968) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 8-(2,3-dihydroxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(2,3-dihydroxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 114344968 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 8-(2,3-dihydroxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cccc(O)c3O)CC2)CN1 |
| InChI | InChI=1S/C15H18N2O4/c18-11-3-1-2-10(13(11)20)14(21)17-6-4-15(5-7-17)8-12(19)16-9-15/h1-3,18,20H,4-9H2,(H,16,19) |
| InChIKey | WQQSGGPXHVEKQC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|