C16H19FN2O3 — CID 50969847
8-(3-fluoro-2-methoxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 50969847) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 8-(3-fluoro-2-methoxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-(3-fluoro-2-methoxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 50969847 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 8-(3-fluoro-2-methoxybenzoyl)-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | COc1c(F)cccc1C(=O)N1CCC2(CC1)CNC(=O)C2 |
| InChI | InChI=1S/C16H19FN2O3/c1-22-14-11(3-2-4-12(14)17)15(21)19-7-5-16(6-8-19)9-13(20)18-10-16/h2-4H,5-10H2,1H3,(H,18,20) |
| InChIKey | ZTAPFCZYDOOZQP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |