C18H25N3O4 — CID 119063300
8-[3-(2-aminoethoxy)-4-methoxybenzoyl]-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 119063300) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 8-[3-(2-aminoethoxy)-4-methoxybenzoyl]-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 8-[3-(2-aminoethoxy)-4-methoxybenzoyl]-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 119063300 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 8-[3-(2-aminoethoxy)-4-methoxybenzoyl]-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | COc1ccc(C(=O)N2CCC3(CC2)CNC(=O)C3)cc1OCCN |
| InChI | InChI=1S/C18H25N3O4/c1-24-14-3-2-13(10-15(14)25-9-6-19)17(23)21-7-4-18(5-8-21)11-16(22)20-12-18/h2-3,10H,4-9,11-12,19H2,1H3,(H,20,22) |
| InChIKey | ZRRHNFNLPAQEQU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |