C18H24N4O5 — CID 154904873
acetic acid;[3-(2-aminoethoxy)-4-methoxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone (PubChem CID 154904873) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is acetic acid;[3-(2-aminoethoxy)-4-methoxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone.
| Compound Name | acetic acid;[3-(2-aminoethoxy)-4-methoxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 154904873 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | acetic acid;[3-(2-aminoethoxy)-4-methoxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone |
| SMILES | CC(=O)O.COc1ccc(C(=O)N2CC(n3cccn3)C2)cc1OCCN |
| InChI | InChI=1S/C16H20N4O3.C2H4O2/c1-22-14-4-3-12(9-15(14)23-8-5-17)16(21)19-10-13(11-19)20-7-2-6-18-20;1-2(3)4/h2-4,6-7,9,13H,5,8,10-11,17H2,1H3;1H3,(H,3,4) |
| InChIKey | HTZXYRDVXKTFRM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |