C13H14BrClFNO — CID 107993984
N-[1-(bromomethyl)cyclopentyl]-4-chloro-3-fluorobenzamide (PubChem CID 107993984) has the molecular formula C13H14BrClFNO and a molecular weight of 334.62 g/mol. Its IUPAC name is N-[1-(bromomethyl)cyclopentyl]-4-chloro-3-fluorobenzamide.
| Compound Name | N-[1-(bromomethyl)cyclopentyl]-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 107993984 |
| Molecular Formula | C13H14BrClFNO |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | N-[1-(bromomethyl)cyclopentyl]-4-chloro-3-fluorobenzamide |
| SMILES | O=C(NC1(CBr)CCCC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H14BrClFNO/c14-8-13(5-1-2-6-13)17-12(18)9-3-4-10(15)11(16)7-9/h3-4,7H,1-2,5-6,8H2,(H,17,18) |
| InChIKey | PFZIUFLRZFIDPP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|