C14H16Br2ClNO — CID 113275490
4-bromo-N-[1-(bromomethyl)cyclohexyl]-3-chlorobenzamide (PubChem CID 113275490) has the molecular formula C14H16Br2ClNO and a molecular weight of 409.55 g/mol. Its IUPAC name is 4-bromo-N-[1-(bromomethyl)cyclohexyl]-3-chlorobenzamide.
| Compound Name | 4-bromo-N-[1-(bromomethyl)cyclohexyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 113275490 |
| Molecular Formula | C14H16Br2ClNO |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 4-bromo-N-[1-(bromomethyl)cyclohexyl]-3-chlorobenzamide |
| SMILES | O=C(NC1(CBr)CCCCC1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C14H16Br2ClNO/c15-9-14(6-2-1-3-7-14)18-13(19)10-4-5-11(16)12(17)8-10/h4-5,8H,1-3,6-7,9H2,(H,18,19) |
| InChIKey | ISFYEKBUSDPNPU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|