C16H18BrClN2 — CID 107994454
1-(2-bromo-4-chlorophenyl)-2-(5-ethyl-2-pyridinyl)-N-methylethanamine (PubChem CID 107994454) has the molecular formula C16H18BrClN2 and a molecular weight of 353.69 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-2-(5-ethyl-2-pyridinyl)-N-methylethanamine.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-2-(5-ethyl-2-pyridinyl)-N-methylethanamine |
|---|---|
| PubChem CID | 107994454 |
| Molecular Formula | C16H18BrClN2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-2-(5-ethyl-2-pyridinyl)-N-methylethanamine |
| SMILES | CCc1ccc(CC(NC)c2ccc(Cl)cc2Br)nc1 |
| InChI | InChI=1S/C16H18BrClN2/c1-3-11-4-6-13(20-10-11)9-16(19-2)14-7-5-12(18)8-15(14)17/h4-8,10,16,19H,3,9H2,1-2H3 |
| InChIKey | VKOCPWMNKRILKP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |