C16H17F3N2 — CID 79733087
2-(5-ethyl-2-pyridinyl)-N-methyl-1-(3,4,5-trifluorophenyl)ethanamine (PubChem CID 79733087) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-(5-ethyl-2-pyridinyl)-N-methyl-1-(3,4,5-trifluorophenyl)ethanamine.
| Compound Name | 2-(5-ethyl-2-pyridinyl)-N-methyl-1-(3,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 79733087 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(5-ethyl-2-pyridinyl)-N-methyl-1-(3,4,5-trifluorophenyl)ethanamine |
| SMILES | CCc1ccc(CC(NC)c2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C16H17F3N2/c1-3-10-4-5-12(21-9-10)8-15(20-2)11-6-13(17)16(19)14(18)7-11/h4-7,9,15,20H,3,8H2,1-2H3 |
| InChIKey | IQGWPYMGJMQZDQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|