C13H14BrClN2O — CID 107994739
2-[5-(2-bromo-4-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine (PubChem CID 107994739) has the molecular formula C13H14BrClN2O and a molecular weight of 329.63 g/mol. Its IUPAC name is 2-[5-(2-bromo-4-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(2-bromo-4-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 107994739 |
| Molecular Formula | C13H14BrClN2O |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-[5-(2-bromo-4-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1ncc(-c2ccc(Cl)cc2Br)o1 |
| InChI | InChI=1S/C13H14BrClN2O/c1-2-16-6-5-13-17-8-12(18-13)10-4-3-9(15)7-11(10)14/h3-4,7-8,16H,2,5-6H2,1H3 |
| InChIKey | UPCJKTSFKUBZOB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|