C13H15ClN2O — CID 65183004
2-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine (PubChem CID 65183004) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 65183004 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1ncc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C13H15ClN2O/c1-2-15-7-6-13-16-9-12(17-13)10-4-3-5-11(14)8-10/h3-5,8-9,15H,2,6-7H2,1H3 |
| InChIKey | SDPQUKONKHNOBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|