C12H11BrClFN2S — CID 107996956
[2-(4-bromothiophen-2-yl)-1-(4-chloro-3-fluorophenyl)ethyl]hydrazine (PubChem CID 107996956) has the molecular formula C12H11BrClFN2S and a molecular weight of 349.66 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1-(4-chloro-3-fluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromothiophen-2-yl)-1-(4-chloro-3-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107996956 |
| Molecular Formula | C12H11BrClFN2S |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1-(4-chloro-3-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(Br)cs1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H11BrClFN2S/c13-8-4-9(18-6-8)5-12(17-16)7-1-2-10(14)11(15)3-7/h1-4,6,12,17H,5,16H2 |
| InChIKey | PGWLBXFPOQRCDF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|