C15H19BrN2OS — CID 105299378
[2-(4-bromothiophen-2-yl)-1-(3-propoxyphenyl)ethyl]hydrazine (PubChem CID 105299378) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1-(3-propoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-(4-bromothiophen-2-yl)-1-(3-propoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105299378 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1-(3-propoxyphenyl)ethyl]hydrazine |
| SMILES | CCCOc1cccc(C(Cc2cc(Br)cs2)NN)c1 |
| InChI | InChI=1S/C15H19BrN2OS/c1-2-6-19-13-5-3-4-11(7-13)15(18-17)9-14-8-12(16)10-20-14/h3-5,7-8,10,15,18H,2,6,9,17H2,1H3 |
| InChIKey | QSMLKUKANNBFEO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|