C14H9BrClNO4 — CID 107998093
3-[(3-bromo-4-chlorobenzoyl)amino]-2-hydroxybenzoic acid (PubChem CID 107998093) has the molecular formula C14H9BrClNO4 and a molecular weight of 370.59 g/mol. Its IUPAC name is 3-[(3-bromo-4-chlorobenzoyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[(3-bromo-4-chlorobenzoyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107998093 |
| Molecular Formula | C14H9BrClNO4 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 3-[(3-bromo-4-chlorobenzoyl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H9BrClNO4/c15-9-6-7(4-5-10(9)16)13(19)17-11-3-1-2-8(12(11)18)14(20)21/h1-6,18H,(H,17,19)(H,20,21) |
| InChIKey | OOTDAFHBFZLYOH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|